C17H14N2O4S2 — CID 8841398
3-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid (PubChem CID 8841398) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 8841398 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 3-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid |
| SMILES | Cc1nc(-c2ccc(NS(=O)(=O)c3cccc(C(=O)O)c3)cc2)cs1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-11-18-16(10-24-11)12-5-7-14(8-6-12)19-25(22,23)15-4-2-3-13(9-15)17(20)21/h2-10,19H,1H3,(H,20,21) |
| InChIKey | LYKQKKDFPRFDMJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |