C18H16N2O4S2 — CID 25335438
3-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoic acid (PubChem CID 25335438) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 25335438 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 3-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(C)c(-c2csc(NS(=O)(=O)c3cccc(C(=O)O)c3)n2)c1 |
| InChI | InChI=1S/C18H16N2O4S2/c1-11-6-7-12(2)15(8-11)16-10-25-18(19-16)20-26(23,24)14-5-3-4-13(9-14)17(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | QJXYTWSTHZBGTE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|