C18H16N2O3S — CID 695891
5-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid (PubChem CID 695891) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 695891 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-[[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid |
| SMILES | Cc1ccc(C)c(-c2csc(Nc3ccc(O)c(C(=O)O)c3)n2)c1 |
| InChI | InChI=1S/C18H16N2O3S/c1-10-3-4-11(2)13(7-10)15-9-24-18(20-15)19-12-5-6-16(21)14(8-12)17(22)23/h3-9,21H,1-2H3,(H,19,20)(H,22,23) |
| InChIKey | FTEFWKWWPUHYIB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|