C20H17N3O2S2 — CID 31046759
3-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]quinoline-8-sulfonamide (PubChem CID 31046759) has the molecular formula C20H17N3O2S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 3-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]quinoline-8-sulfonamide.
| Compound Name | 3-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 31046759 |
| Molecular Formula | C20H17N3O2S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]quinoline-8-sulfonamide |
| SMILES | Cc1cnc2c(S(=O)(=O)Nc3cccc(-c4csc(C)n4)c3)cccc2c1 |
| InChI | InChI=1S/C20H17N3O2S2/c1-13-9-16-6-4-8-19(20(16)21-11-13)27(24,25)23-17-7-3-5-15(10-17)18-12-26-14(2)22-18/h3-12,23H,1-2H3 |
| InChIKey | QDEDYACRQYWWKT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |