C12H16N4O2S2 — CID 43742065
2-methyl-4-[1-[3-(sulfamoylamino)anilino]ethyl]-1,3-thiazole (PubChem CID 43742065) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-methyl-4-[1-[3-(sulfamoylamino)anilino]ethyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[1-[3-(sulfamoylamino)anilino]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43742065 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-methyl-4-[1-[3-(sulfamoylamino)anilino]ethyl]-1,3-thiazole |
| SMILES | Cc1nc(C(C)Nc2cccc(NS(N)(=O)=O)c2)cs1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-8(12-7-19-9(2)15-12)14-10-4-3-5-11(6-10)16-20(13,17)18/h3-8,14,16H,1-2H3,(H2,13,17,18) |
| InChIKey | LSCPMXHBFKFDIQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |