C14H13N3O2S — CID 43670137
5-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]isoindole-1,3-dione (PubChem CID 43670137) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]isoindole-1,3-dione.
| Compound Name | 5-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 43670137 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]isoindole-1,3-dione |
| SMILES | Cc1nc(C(C)Nc2ccc3c(c2)C(=O)NC3=O)cs1 |
| InChI | InChI=1S/C14H13N3O2S/c1-7(12-6-20-8(2)16-12)15-9-3-4-10-11(5-9)14(19)17-13(10)18/h3-7,15H,1-2H3,(H,17,18,19) |
| InChIKey | DHPRETKZJHFQGF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|