C14H11BrN2O2S — CID 43766297
5-[1-(3-bromothiophen-2-yl)ethylamino]isoindole-1,3-dione (PubChem CID 43766297) has the molecular formula C14H11BrN2O2S and a molecular weight of 351.23 g/mol. Its IUPAC name is 5-[1-(3-bromothiophen-2-yl)ethylamino]isoindole-1,3-dione.
| Compound Name | 5-[1-(3-bromothiophen-2-yl)ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 43766297 |
| Molecular Formula | C14H11BrN2O2S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 5-[1-(3-bromothiophen-2-yl)ethylamino]isoindole-1,3-dione |
| SMILES | CC(Nc1ccc2c(c1)C(=O)NC2=O)c1sccc1Br |
| InChI | InChI=1S/C14H11BrN2O2S/c1-7(12-11(15)4-5-20-12)16-8-2-3-9-10(6-8)14(19)17-13(9)18/h2-7,16H,1H3,(H,17,18,19) |
| InChIKey | KTVQFKYAYNFNJH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|