C14H16BrClN2S — CID 55191782
4-N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 55191782) has the molecular formula C14H16BrClN2S and a molecular weight of 359.72 g/mol. Its IUPAC name is 4-N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 55191782 |
| Molecular Formula | C14H16BrClN2S |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 4-N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | CC(Nc1ccc(N(C)C)c(Cl)c1)c1sccc1Br |
| InChI | InChI=1S/C14H16BrClN2S/c1-9(14-11(15)6-7-19-14)17-10-4-5-13(18(2)3)12(16)8-10/h4-9,17H,1-3H3 |
| InChIKey | UJXQNXTZWAKKRM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|