C16H21ClN2S — CID 63451348
2-chloro-4-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 63451348) has the molecular formula C16H21ClN2S and a molecular weight of 308.88 g/mol. Its IUPAC name is 2-chloro-4-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63451348 |
| Molecular Formula | C16H21ClN2S |
| Molecular Weight | 308.88 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-chloro-4-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | Cc1cc(C(C)Nc2ccc(N(C)C)c(Cl)c2)c(C)s1 |
| InChI | InChI=1S/C16H21ClN2S/c1-10-8-14(12(3)20-10)11(2)18-13-6-7-16(19(4)5)15(17)9-13/h6-9,11,18H,1-5H3 |
| InChIKey | DKURGYQJIMUJIT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.88 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|