C18H23ClN2 — CID 63450867
2-chloro-4-N-[1-(3,4-dimethylphenyl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 63450867) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 2-chloro-4-N-[1-(3,4-dimethylphenyl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-[1-(3,4-dimethylphenyl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63450867 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-chloro-4-N-[1-(3,4-dimethylphenyl)ethyl]-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | Cc1ccc(C(C)Nc2ccc(N(C)C)c(Cl)c2)cc1C |
| InChI | InChI=1S/C18H23ClN2/c1-12-6-7-15(10-13(12)2)14(3)20-16-8-9-18(21(4)5)17(19)11-16/h6-11,14,20H,1-5H3 |
| InChIKey | AYUNITIAXQKASV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|