C15H15BrN2O2S — CID 43781541
6-[1-(3-bromothiophen-2-yl)ethylamino]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 43781541) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 6-[1-(3-bromothiophen-2-yl)ethylamino]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(3-bromothiophen-2-yl)ethylamino]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43781541 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 6-[1-(3-bromothiophen-2-yl)ethylamino]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(NC(C)c3sccc3Br)cc2NC1=O |
| InChI | InChI=1S/C15H15BrN2O2S/c1-8(14-11(16)5-6-21-14)17-10-3-4-13-12(7-10)18-15(19)9(2)20-13/h3-9,17H,1-2H3,(H,18,19) |
| InChIKey | WWHJIZKMEYZQDO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|