C16H16N2S — CID 43680346
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]naphthalen-2-amine (PubChem CID 43680346) has the molecular formula C16H16N2S and a molecular weight of 268.39 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]naphthalen-2-amine.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 43680346 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]naphthalen-2-amine |
| SMILES | Cc1nc(C(C)Nc2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C16H16N2S/c1-11(16-10-19-12(2)18-16)17-15-8-7-13-5-3-4-6-14(13)9-15/h3-11,17H,1-2H3 |
| InChIKey | WOUBKEYKFHIJHX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |