C15H20N2S — CID 43670202
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-propylaniline (PubChem CID 43670202) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-propylaniline.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-propylaniline |
|---|---|
| PubChem CID | 43670202 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-propylaniline |
| SMILES | CCCc1ccc(NC(C)c2csc(C)n2)cc1 |
| InChI | InChI=1S/C15H20N2S/c1-4-5-13-6-8-14(9-7-13)16-11(2)15-10-18-12(3)17-15/h6-11,16H,4-5H2,1-3H3 |
| InChIKey | KYZBBFQBVIKNAN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |