C10H12N2S2 — CID 66351418
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-3-amine (PubChem CID 66351418) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-3-amine.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66351418 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-3-amine |
| SMILES | Cc1nc(C(C)Nc2ccsc2)cs1 |
| InChI | InChI=1S/C10H12N2S2/c1-7(10-6-14-8(2)12-10)11-9-3-4-13-5-9/h3-7,11H,1-2H3 |
| InChIKey | XNLGJYYGFXNPRG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |