C18H18N2S — CID 43716894
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-phenylaniline (PubChem CID 43716894) has the molecular formula C18H18N2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-phenylaniline.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-phenylaniline |
|---|---|
| PubChem CID | 43716894 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-phenylaniline |
| SMILES | Cc1nc(C(C)Nc2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C18H18N2S/c1-13(18-12-21-14(2)20-18)19-17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-13,19H,1-2H3 |
| InChIKey | UNBNYXBFQOBWAW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |