C19H17N2O4S2- — CID 8002269
3-[4-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]phenyl]propanoate (PubChem CID 8002269) has the molecular formula C19H17N2O4S2- and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[4-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]phenyl]propanoate.
| Compound Name | 3-[4-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 8002269 |
| Molecular Formula | C19H17N2O4S2- |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 3-[4-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]phenyl]propanoate |
| SMILES | Cc1nc(-c2cccc(NS(=O)(=O)c3ccc(CCC(=O)[O-])cc3)c2)cs1 |
| InChI | InChI=1S/C19H18N2O4S2/c1-13-20-18(12-26-13)15-3-2-4-16(11-15)21-27(24,25)17-8-5-14(6-9-17)7-10-19(22)23/h2-6,8-9,11-12,21H,7,10H2,1H3,(H,22,23)/p-1 |
| InChIKey | DVAKZABAHMNVBV-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |