C23H14N2O2S — CID 16613201
9-oxo-N-(4-phenyl-1,3-thiazol-2-yl)fluorene-2-carboxamide (PubChem CID 16613201) has the molecular formula C23H14N2O2S and a molecular weight of 382.44 g/mol. Its IUPAC name is 9-oxo-N-(4-phenyl-1,3-thiazol-2-yl)fluorene-2-carboxamide.
| Compound Name | 9-oxo-N-(4-phenyl-1,3-thiazol-2-yl)fluorene-2-carboxamide |
|---|---|
| PubChem CID | 16613201 |
| Molecular Formula | C23H14N2O2S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 9-oxo-N-(4-phenyl-1,3-thiazol-2-yl)fluorene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H14N2O2S/c26-21-18-9-5-4-8-16(18)17-11-10-15(12-19(17)21)22(27)25-23-24-20(13-28-23)14-6-2-1-3-7-14/h1-13H,(H,24,25,27) |
| InChIKey | IRBJYECDYBMPKI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |