C26H19N3O3S — CID 108769722
1,3-dioxo-2-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)isoindole-5-carboxamide (PubChem CID 108769722) has the molecular formula C26H19N3O3S and a molecular weight of 453.52 g/mol. Its IUPAC name is 1,3-dioxo-2-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)isoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-2-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108769722 |
| Molecular Formula | C26H19N3O3S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 1,3-dioxo-2-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)isoindole-5-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O |
| InChI | InChI=1S/C26H19N3O3S/c30-23(28-26-27-22(16-33-26)18-9-5-2-6-10-18)19-11-12-20-21(15-19)25(32)29(24(20)31)14-13-17-7-3-1-4-8-17/h1-12,15-16H,13-14H2,(H,27,28,30) |
| InChIKey | LNUYULFHIXNZJE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|