C26H27N3O4S — CID 16557483
N-[4-[4-(2-methoxyethyl)phenyl]-1,3-thiazol-2-yl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 16557483) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyethyl)phenyl]-1,3-thiazol-2-yl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-[4-(2-methoxyethyl)phenyl]-1,3-thiazol-2-yl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 16557483 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[4-[4-(2-methoxyethyl)phenyl]-1,3-thiazol-2-yl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCc1ccc(-c2csc(NC(=O)c3ccc4c(c3)C(=O)N(CCC(C)C)C4=O)n2)cc1 |
| InChI | InChI=1S/C26H27N3O4S/c1-16(2)10-12-29-24(31)20-9-8-19(14-21(20)25(29)32)23(30)28-26-27-22(15-34-26)18-6-4-17(5-7-18)11-13-33-3/h4-9,14-16H,10-13H2,1-3H3,(H,27,28,30) |
| InChIKey | GMSGGLBSCANTEE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|