C19H12ClN3O3S — CID 17499132
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17499132) has the molecular formula C19H12ClN3O3S and a molecular weight of 397.84 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17499132 |
| Molecular Formula | C19H12ClN3O3S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(Cl)cc4)cs3)cc2C1=O |
| InChI | InChI=1S/C19H12ClN3O3S/c1-23-17(25)13-7-4-11(8-14(13)18(23)26)16(24)22-19-21-15(9-27-19)10-2-5-12(20)6-3-10/h2-9H,1H3,(H,21,22,24) |
| InChIKey | WXWUYZPYADKWEO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|