C24H21N3O4S — CID 16550442
1,3-dioxo-2-prop-2-enyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide (PubChem CID 16550442) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 1,3-dioxo-2-prop-2-enyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-2-prop-2-enyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 16550442 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1,3-dioxo-2-prop-2-enyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(OCCC)cc4)cs3)cc2C1=O |
| InChI | InChI=1S/C24H21N3O4S/c1-3-11-27-22(29)18-10-7-16(13-19(18)23(27)30)21(28)26-24-25-20(14-32-24)15-5-8-17(9-6-15)31-12-4-2/h3,5-10,13-14H,1,4,11-12H2,2H3,(H,25,26,28) |
| InChIKey | APPOEWWMZFGGCM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|