C21H21N5O2S — CID 16550447
1-ethyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzotriazole-5-carboxamide (PubChem CID 16550447) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is 1-ethyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 16550447 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-ethyl-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzotriazole-5-carboxamide |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)c3ccc4c(c3)nnn4CC)n2)cc1 |
| InChI | InChI=1S/C21H21N5O2S/c1-3-11-28-16-8-5-14(6-9-16)18-13-29-21(22-18)23-20(27)15-7-10-19-17(12-15)24-25-26(19)4-2/h5-10,12-13H,3-4,11H2,1-2H3,(H,22,23,27) |
| InChIKey | LIPHMGCUJWFZBS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |