C22H19N3O3S — CID 55866187
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide (PubChem CID 55866187) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55866187 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide |
| SMILES | Cc1nc(CNC(=O)c2ccc3c(c2)C(=O)N(CCc2ccccc2)C3=O)cs1 |
| InChI | InChI=1S/C22H19N3O3S/c1-14-24-17(13-29-14)12-23-20(26)16-7-8-18-19(11-16)22(28)25(21(18)27)10-9-15-5-3-2-4-6-15/h2-8,11,13H,9-10,12H2,1H3,(H,23,26) |
| InChIKey | OFTNCNDPPMLFFJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|