C19H18N2O3 — CID 3391897
N-benzyl-1,3-dioxo-2-propylisoindole-5-carboxamide (PubChem CID 3391897) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-benzyl-1,3-dioxo-2-propylisoindole-5-carboxamide.
| Compound Name | N-benzyl-1,3-dioxo-2-propylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 3391897 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-benzyl-1,3-dioxo-2-propylisoindole-5-carboxamide |
| SMILES | CCCN1C(=O)c2ccc(C(=O)NCc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C19H18N2O3/c1-2-10-21-18(23)15-9-8-14(11-16(15)19(21)24)17(22)20-12-13-6-4-3-5-7-13/h3-9,11H,2,10,12H2,1H3,(H,20,22) |
| InChIKey | QCQYOBYKRGTODF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|