C25H21N3O5 — CID 55732320
methyl N-[4-[[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]phenyl]carbamate (PubChem CID 55732320) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl N-[4-[[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55732320 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl N-[4-[[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(CNC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-33-25(32)27-19-10-7-16(8-11-19)14-26-22(29)18-9-12-20-21(13-18)24(31)28(23(20)30)15-17-5-3-2-4-6-17/h2-13H,14-15H2,1H3,(H,26,29)(H,27,32) |
| InChIKey | OWLMJZISOMVUFO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|