C17H16N2OS — CID 133371204
2-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol (PubChem CID 133371204) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol.
| Compound Name | 2-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 133371204 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol |
| SMILES | OCC(Nc1nc(-c2ccccc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C17H16N2OS/c20-11-15(13-7-3-1-4-8-13)18-17-19-16(12-21-17)14-9-5-2-6-10-14/h1-10,12,15,20H,11H2,(H,18,19) |
| InChIKey | QUPWPGLGDVTFIO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |