C11H13N3OS — CID 64982613
2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-phenylethanol (PubChem CID 64982613) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-phenylethanol.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-phenylethanol |
|---|---|
| PubChem CID | 64982613 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-phenylethanol |
| SMILES | Cc1nnc(NC(CO)c2ccccc2)s1 |
| InChI | InChI=1S/C11H13N3OS/c1-8-13-14-11(16-8)12-10(7-15)9-5-3-2-4-6-9/h2-6,10,15H,7H2,1H3,(H,12,14) |
| InChIKey | JJFVHIIWNWRCOR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |