C13H17N3OS — CID 65274322
2-phenyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethanol (PubChem CID 65274322) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-phenyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethanol.
| Compound Name | 2-phenyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 65274322 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-phenyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethanol |
| SMILES | CCCc1nsc(NC(CO)c2ccccc2)n1 |
| InChI | InChI=1S/C13H17N3OS/c1-2-6-12-15-13(18-16-12)14-11(9-17)10-7-4-3-5-8-10/h3-5,7-8,11,17H,2,6,9H2,1H3,(H,14,15,16) |
| InChIKey | LMAQLDAXUDKIEU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |