C8H13N3O2S — CID 122049343
(2S)-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanoic acid (PubChem CID 122049343) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is (2S)-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanoic acid.
| Compound Name | (2S)-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 122049343 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (2S)-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanoic acid |
| SMILES | CCCc1nsc(N[C@@H](C)C(=O)O)n1 |
| InChI | InChI=1S/C8H13N3O2S/c1-3-4-6-10-8(14-11-6)9-5(2)7(12)13/h5H,3-4H2,1-2H3,(H,12,13)(H,9,10,11)/t5-/m0/s1 |
| InChIKey | JJWMOGWRTMJNEO-YFKPBYRVSA-N |
| XLogP | 1.38 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |