C11H15N3S2 — CID 65271045
3-propyl-N-(1-thiophen-2-ylethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65271045) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 3-propyl-N-(1-thiophen-2-ylethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-propyl-N-(1-thiophen-2-ylethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65271045 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-propyl-N-(1-thiophen-2-ylethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCCc1nsc(NC(C)c2cccs2)n1 |
| InChI | InChI=1S/C11H15N3S2/c1-3-5-10-13-11(16-14-10)12-8(2)9-6-4-7-15-9/h4,6-8H,3,5H2,1-2H3,(H,12,13,14) |
| InChIKey | KDAYICSADKTINK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |