C13H16ClN3S — CID 80940733
6-chloro-2-propyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine (PubChem CID 80940733) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 6-chloro-2-propyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-propyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80940733 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-chloro-2-propyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine |
| SMILES | CCCc1nc(Cl)cc(NC(C)c2cccs2)n1 |
| InChI | InChI=1S/C13H16ClN3S/c1-3-5-12-16-11(14)8-13(17-12)15-9(2)10-6-4-7-18-10/h4,6-9H,3,5H2,1-2H3,(H,15,16,17) |
| InChIKey | JMEWGOYBFIIHGT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |