C13H22ClN3 — CID 80940416
6-chloro-N-(4-methylpentan-2-yl)-2-propylpyrimidin-4-amine (PubChem CID 80940416) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 6-chloro-N-(4-methylpentan-2-yl)-2-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(4-methylpentan-2-yl)-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80940416 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 6-chloro-N-(4-methylpentan-2-yl)-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cl)cc(NC(C)CC(C)C)n1 |
| InChI | InChI=1S/C13H22ClN3/c1-5-6-12-16-11(14)8-13(17-12)15-10(4)7-9(2)3/h8-10H,5-7H2,1-4H3,(H,15,16,17) |
| InChIKey | CFMRTUQWQQXJDW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |