C9H15ClN4 — CID 83020436
2-(6-chloro-2-propylpyrimidin-4-yl)-1,1-dimethylhydrazine (PubChem CID 83020436) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is 2-(6-chloro-2-propylpyrimidin-4-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(6-chloro-2-propylpyrimidin-4-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83020436 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-(6-chloro-2-propylpyrimidin-4-yl)-1,1-dimethylhydrazine |
| SMILES | CCCc1nc(Cl)cc(NN(C)C)n1 |
| InChI | InChI=1S/C9H15ClN4/c1-4-5-8-11-7(10)6-9(12-8)13-14(2)3/h6H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | WVVDDHGWEDDUSF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|