C16H17ClN4 — CID 106192790
4-[1-[(6-chloro-2-propylpyrimidin-4-yl)amino]ethyl]benzonitrile (PubChem CID 106192790) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-[1-[(6-chloro-2-propylpyrimidin-4-yl)amino]ethyl]benzonitrile.
| Compound Name | 4-[1-[(6-chloro-2-propylpyrimidin-4-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 106192790 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[1-[(6-chloro-2-propylpyrimidin-4-yl)amino]ethyl]benzonitrile |
| SMILES | CCCc1nc(Cl)cc(NC(C)c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C16H17ClN4/c1-3-4-15-20-14(17)9-16(21-15)19-11(2)13-7-5-12(10-18)6-8-13/h5-9,11H,3-4H2,1-2H3,(H,19,20,21) |
| InChIKey | FBYSQYIZQKAGEG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |