C16H15N3OS — CID 107648394
4-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-phenylmethyl]phenol (PubChem CID 107648394) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-phenylmethyl]phenol.
| Compound Name | 4-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-phenylmethyl]phenol |
|---|---|
| PubChem CID | 107648394 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-phenylmethyl]phenol |
| SMILES | Cc1nnc(NC(c2ccccc2)c2ccc(O)cc2)s1 |
| InChI | InChI=1S/C16H15N3OS/c1-11-18-19-16(21-11)17-15(12-5-3-2-4-6-12)13-7-9-14(20)10-8-13/h2-10,15,20H,1H3,(H,17,19) |
| InChIKey | QVNOOVLDVAEUQP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |