C10H12N2O6P2S — CID 19992029
[[(4-phenyl-1,3-thiazol-2-yl)amino]-phosphonomethyl]phosphonic acid (PubChem CID 19992029) has the molecular formula C10H12N2O6P2S and a molecular weight of 350.23 g/mol. Its IUPAC name is [[(4-phenyl-1,3-thiazol-2-yl)amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[(4-phenyl-1,3-thiazol-2-yl)amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 19992029 |
| Molecular Formula | C10H12N2O6P2S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | [[(4-phenyl-1,3-thiazol-2-yl)amino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1nc(-c2ccccc2)cs1)P(=O)(O)O |
| InChI | InChI=1S/C10H12N2O6P2S/c13-19(14,15)10(20(16,17)18)12-9-11-8(6-21-9)7-4-2-1-3-5-7/h1-6,10H,(H,11,12)(H2,13,14,15)(H2,16,17,18) |
| InChIKey | QXQBDRYZIFLUOL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|