C13H16N2OS — CID 141197141
2-methyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-1-ol (PubChem CID 141197141) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-methyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-1-ol.
| Compound Name | 2-methyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 141197141 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-methyl-2-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-1-ol |
| SMILES | CC(C)(CO)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C13H16N2OS/c1-13(2,9-16)15-12-14-11(8-17-12)10-6-4-3-5-7-10/h3-8,16H,9H2,1-2H3,(H,14,15) |
| InChIKey | YGPNWKXBFJPVPP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |