C18H17N3OS — CID 59364038
(2E)-3-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propan-1-ol (PubChem CID 59364038) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is (2E)-3-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propan-1-ol.
| Compound Name | (2E)-3-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propan-1-ol |
|---|---|
| PubChem CID | 59364038 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2E)-3-phenyl-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propan-1-ol |
| SMILES | OC/C(Cc1ccccc1)=N/Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H17N3OS/c22-12-16(11-14-7-3-1-4-8-14)20-21-18-19-17(13-23-18)15-9-5-2-6-10-15/h1-10,13,22H,11-12H2,(H,19,21)/b20-16+ |
| InChIKey | PWAIFHLJTTVMOP-CAPFRKAQSA-N |
| XLogP | 3.81 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|