C24H20ClN3S — CID 25014803
4-(4-chlorophenyl)-N-(1,3-diphenylpropan-2-ylideneamino)-1,3-thiazol-2-amine (PubChem CID 25014803) has the molecular formula C24H20ClN3S and a molecular weight of 417.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(1,3-diphenylpropan-2-ylideneamino)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(1,3-diphenylpropan-2-ylideneamino)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 25014803 |
| Molecular Formula | C24H20ClN3S |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(1,3-diphenylpropan-2-ylideneamino)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(NN=C(Cc3ccccc3)Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H20ClN3S/c25-21-13-11-20(12-14-21)23-17-29-24(26-23)28-27-22(15-18-7-3-1-4-8-18)16-19-9-5-2-6-10-19/h1-14,17H,15-16H2,(H,26,28) |
| InChIKey | TWWQCIDUVKZRKS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|