C18H16ClN3OS — CID 43814202
2-(benzylamino)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 43814202) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is 2-(benzylamino)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(benzylamino)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 43814202 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-(benzylamino)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CNCc1ccccc1)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H16ClN3OS/c19-15-8-6-14(7-9-15)16-12-24-18(21-16)22-17(23)11-20-10-13-4-2-1-3-5-13/h1-9,12,20H,10-11H2,(H,21,22,23) |
| InChIKey | DCRSHJAKFGBBSD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |