C22H23ClN4OS — CID 22198171
2-(4-benzylpiperazin-1-yl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 22198171) has the molecular formula C22H23ClN4OS and a molecular weight of 426.97 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 22198171 |
| Molecular Formula | C22H23ClN4OS |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C22H23ClN4OS/c23-19-8-6-18(7-9-19)20-16-29-22(24-20)25-21(28)15-27-12-10-26(11-13-27)14-17-4-2-1-3-5-17/h1-9,16H,10-15H2,(H,24,25,28) |
| InChIKey | RMDBSHNRJDAAKI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |