C18H12Cl3N3O2S — CID 118706350
(2Z)-3-(4-chlorophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid (PubChem CID 118706350) has the molecular formula C18H12Cl3N3O2S and a molecular weight of 440.74 g/mol. Its IUPAC name is (2Z)-3-(4-chlorophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid.
| Compound Name | (2Z)-3-(4-chlorophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 118706350 |
| Molecular Formula | C18H12Cl3N3O2S |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | (2Z)-3-(4-chlorophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
| SMILES | O=C(O)/C(Cc1ccc(Cl)cc1)=N\Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C18H12Cl3N3O2S/c19-12-4-1-10(2-5-12)7-15(17(25)26)23-24-18-22-16(9-27-18)11-3-6-13(20)14(21)8-11/h1-6,8-9H,7H2,(H,22,24)(H,25,26)/b23-15- |
| InChIKey | YWEAITVDRJLMLP-HAHDFKILSA-N |
| XLogP | 5.87 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|