C19H12Cl2N4O2S — CID 140611605
2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-2-(1H-indol-3-yl)acetic acid (PubChem CID 140611605) has the molecular formula C19H12Cl2N4O2S and a molecular weight of 431.30 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-2-(1H-indol-3-yl)acetic acid.
| Compound Name | 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-2-(1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 140611605 |
| Molecular Formula | C19H12Cl2N4O2S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-2-(1H-indol-3-yl)acetic acid |
| SMILES | O=C(O)C(=NNc1nc(-c2ccc(Cl)c(Cl)c2)cs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H12Cl2N4O2S/c20-13-6-5-10(7-14(13)21)16-9-28-19(23-16)25-24-17(18(26)27)12-8-22-15-4-2-1-3-11(12)15/h1-9,22H,(H,23,25)(H,26,27) |
| InChIKey | SEFTWILJKNOEKB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|