C21H14N4OS — CID 102382489
(E)-2-(1H-indole-3-carbonyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile (PubChem CID 102382489) has the molecular formula C21H14N4OS and a molecular weight of 370.44 g/mol. Its IUPAC name is (E)-2-(1H-indole-3-carbonyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-indole-3-carbonyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 102382489 |
| Molecular Formula | C21H14N4OS |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (E)-2-(1H-indole-3-carbonyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1nc(-c2ccccc2)cs1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H14N4OS/c22-10-15(20(26)17-12-23-18-9-5-4-8-16(17)18)11-24-21-25-19(13-27-21)14-6-2-1-3-7-14/h1-9,11-13,23H,(H,24,25)/b15-11+ |
| InChIKey | YSKSSQNJGXBLDV-RVDMUPIBSA-N |
| XLogP | 4.99 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|