C23H17N5O2S — CID 25281580
2-(1H-indol-3-yl)-N-[5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-yl]-2-oxoacetamide (PubChem CID 25281580) has the molecular formula C23H17N5O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-yl]-2-oxoacetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 25281580 |
| Molecular Formula | C23H17N5O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2c[nH]c3ccccc23)n(-c2nc(-c3ccccc3)cs2)n1 |
| InChI | InChI=1S/C23H17N5O2S/c1-14-11-20(26-22(30)21(29)17-12-24-18-10-6-5-9-16(17)18)28(27-14)23-25-19(13-31-23)15-7-3-2-4-8-15/h2-13,24H,1H3,(H,26,30) |
| InChIKey | CEAVMWFVZCXKJQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|