C20H14Cl2N4OS — CID 136602565
(1Z)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1-(1H-indol-3-yl)propan-2-one (PubChem CID 136602565) has the molecular formula C20H14Cl2N4OS and a molecular weight of 429.33 g/mol. Its IUPAC name is (1Z)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1-(1H-indol-3-yl)propan-2-one.
| Compound Name | (1Z)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1-(1H-indol-3-yl)propan-2-one |
|---|---|
| PubChem CID | 136602565 |
| Molecular Formula | C20H14Cl2N4OS |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (1Z)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1-(1H-indol-3-yl)propan-2-one |
| SMILES | CC(=O)/C(=N\Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H14Cl2N4OS/c1-11(27)19(14-9-23-17-5-3-2-4-13(14)17)25-26-20-24-18(10-28-20)12-6-7-15(21)16(22)8-12/h2-10,23H,1H3,(H,24,26)/b25-19+ |
| InChIKey | GDKRZFJVCMYIQB-NCELDCMTSA-N |
| XLogP | 6.00 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|