C18H13ClN4S — CID 2788394
4-(4-chlorophenyl)-N-(1H-indol-3-ylmethylideneamino)-1,3-thiazol-2-amine (PubChem CID 2788394) has the molecular formula C18H13ClN4S and a molecular weight of 352.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(1H-indol-3-ylmethylideneamino)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(1H-indol-3-ylmethylideneamino)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2788394 |
| Molecular Formula | C18H13ClN4S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(1H-indol-3-ylmethylideneamino)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(NN=Cc3c[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C18H13ClN4S/c19-14-7-5-12(6-8-14)17-11-24-18(22-17)23-21-10-13-9-20-16-4-2-1-3-15(13)16/h1-11,20H,(H,22,23) |
| InChIKey | HFAWWSMSCNKBBA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|