C19H15N3S — CID 137224330
1-(1H-indol-3-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimine (PubChem CID 137224330) has the molecular formula C19H15N3S and a molecular weight of 317.42 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimine.
| Compound Name | 1-(1H-indol-3-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 137224330 |
| Molecular Formula | C19H15N3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-(1H-indol-3-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimine |
| SMILES | Cc1ccc(-c2csc(N=Cc3c[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C19H15N3S/c1-13-6-8-14(9-7-13)18-12-23-19(22-18)21-11-15-10-20-17-5-3-2-4-16(15)17/h2-12,20H,1H3 |
| InChIKey | KVEPKUQFWMDWPZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|