C32H24N4O2S2Zn — CID 135539792
bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc (PubChem CID 135539792) has the molecular formula C32H24N4O2S2Zn and a molecular weight of 626.09 g/mol. Its IUPAC name is bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc.
| Compound Name | bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc |
|---|---|
| PubChem CID | 135539792 |
| Molecular Formula | C32H24N4O2S2Zn |
| Molecular Weight | 626.09 g/mol |
| Exact Mass | 624.06 |
| IUPAC Name | bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc |
| SMILES | Oc1ccccc1/C=N/c1nc(-c2ccccc2)cs1.Oc1ccccc1/C=N/c1nc(-c2ccccc2)cs1.[Zn] |
| InChI | InChI=1S/2C16H12N2OS.Zn/c2*19-15-9-5-4-8-13(15)10-17-16-18-14(11-20-16)12-6-2-1-3-7-12;/h2*1-11,19H;/b2*17-10+; |
| InChIKey | MCYIFUWZDXFNHI-WVWZWRPUSA-N |
| XLogP | 8.53 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.09 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|