About bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc
bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc (PubChem CID 135539792) has the molecular formula C32H24N4O2S2Zn
and a molecular weight of 626.09 g/mol. Its IUPAC name is bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc.
Molecular Properties
| Compound Name | bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc |
| PubChem CID | 135539792 |
| Molecular Formula | C32H24N4O2S2Zn |
| Molecular Weight | 626.09 g/mol |
| Exact Mass | 624.06 |
| IUPAC Name | bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc |
| SMILES | Oc1ccccc1/C=N/c1nc(-c2ccccc2)cs1.Oc1ccccc1/C=N/c1nc(-c2ccccc2)cs1.[Zn] |
| InChI | InChI=1S/2C16H12N2OS.Zn/c2*19-15-9-5-4-8-13(15)10-17-16-18-14(11-20-16)12-6-2-1-3-7-12;/h2*1-11,19H;/b2*17-10+; |
| InChIKey | MCYIFUWZDXFNHI-WVWZWRPUSA-N |
| XLogP | 8.53 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.09 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc?
The IUPAC name of bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc (CID 135539792) is bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc.
What is the SMILES notation for bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc?
The canonical SMILES for bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc is Oc1ccccc1/C=N/c1nc(-c2ccccc2)cs1.Oc1ccccc1/C=N/c1nc(-c2ccccc2)cs1.[Zn].
What is the InChIKey of bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc?
The InChIKey is MCYIFUWZDXFNHI-WVWZWRPUSA-N. The full InChI is InChI=1S/2C16H12N2OS.Zn/c2*19-15-9-5-4-8-13(15)10-17-16-18-14(11-20-16)12-6-2-1-3-7-12;/h2*1-11,19H;/b2*17-10+;.
What are the key properties of bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc?
bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc has a molecular weight of 626.09 g/mol, XLogP of 8.53, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol);zinc is sourced from PubChem (CID 135539792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).