C16H11BrN2OS — CID 135489146
5-bromo-2-[(Z)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol (PubChem CID 135489146) has the molecular formula C16H11BrN2OS and a molecular weight of 359.25 g/mol. Its IUPAC name is 5-bromo-2-[(Z)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol.
| Compound Name | 5-bromo-2-[(Z)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135489146 |
| Molecular Formula | C16H11BrN2OS |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 5-bromo-2-[(Z)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol |
| SMILES | Oc1cc(Br)ccc1/C=N\c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H11BrN2OS/c17-13-7-6-12(15(20)8-13)9-18-16-19-14(10-21-16)11-4-2-1-3-5-11/h1-10,20H/b18-9- |
| InChIKey | SRYBBNBDFFQCIO-NVMNQCDNSA-N |
| XLogP | 5.03 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|